C19H29FO2 — CID 67024829
(7R,8R,9S,10R,13S,14S,16R,17R)-16-fluoro-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-7,17-diol (PubChem CID 67024829) has the molecular formula C19H29FO2 and a molecular weight of 308.44 g/mol. Its IUPAC name is (7R,8R,9S,10R,13S,14S,16R,17R)-16-fluoro-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-7,17-diol.
| Compound Name | (7R,8R,9S,10R,13S,14S,16R,17R)-16-fluoro-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-7,17-diol |
|---|---|
| PubChem CID | 67024829 |
| Molecular Formula | C19H29FO2 |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | (7R,8R,9S,10R,13S,14S,16R,17R)-16-fluoro-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-7,17-diol |
| SMILES | C[C@]12CC[C@H]3[C@@H]([C@H](O)CC4=CCCC[C@@]43C)[C@@H]1C[C@@H](F)[C@@H]2O |
| InChI | InChI=1S/C19H29FO2/c1-18-7-4-3-5-11(18)9-15(21)16-12(18)6-8-19(2)13(16)10-14(20)17(19)22/h5,12-17,21-22H,3-4,6-10H2,1-2H3/t12-,13-,14+,15+,16+,17-,18-,19-/m0/s1 |
| InChIKey | OFLGRMHJEPXSOG-YPQZYRTGSA-N |
| XLogP | 3.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|