About 2,7-phenanthroline;1,4-xylene
2,7-phenanthroline;1,4-xylene (PubChem CID 67025193) has the molecular formula C20H18N2
and a molecular weight of 286.38 g/mol. Its IUPAC name is 2,7-phenanthroline;1,4-xylene.
Molecular Properties
| Compound Name | 2,7-phenanthroline;1,4-xylene |
| PubChem CID | 67025193 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2,7-phenanthroline;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.c1cnc2ccc3ccncc3c2c1 |
| InChI | InChI=1S/C12H8N2.C8H10/c1-2-10-11-8-13-7-5-9(11)3-4-12(10)14-6-1;1-7-3-5-8(2)6-4-7/h1-8H;3-6H,1-2H3 |
| InChIKey | QMRUZXFPIBRTNE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,7-phenanthroline;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-phenanthroline;1,4-xylene?
The IUPAC name of 2,7-phenanthroline;1,4-xylene (CID 67025193) is 2,7-phenanthroline;1,4-xylene.
What is the SMILES notation for 2,7-phenanthroline;1,4-xylene?
The canonical SMILES for 2,7-phenanthroline;1,4-xylene is Cc1ccc(C)cc1.c1cnc2ccc3ccncc3c2c1.
What is the InChIKey of 2,7-phenanthroline;1,4-xylene?
The InChIKey is QMRUZXFPIBRTNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C8H10/c1-2-10-11-8-13-7-5-9(11)3-4-12(10)14-6-1;1-7-3-5-8(2)6-4-7/h1-8H;3-6H,1-2H3.
What are the key properties of 2,7-phenanthroline;1,4-xylene?
2,7-phenanthroline;1,4-xylene has a molecular weight of 286.38 g/mol, XLogP of 5.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-phenanthroline;1,4-xylene is sourced from PubChem (CID 67025193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).