C15H23F2N3O2 — CID 67025239
tert-butyl 3-amino-5,6-difluoro-2-piperidin-4-yl-2H-pyridine-1-carboxylate (PubChem CID 67025239) has the molecular formula C15H23F2N3O2 and a molecular weight of 315.36 g/mol. Its IUPAC name is tert-butyl 3-amino-5,6-difluoro-2-piperidin-4-yl-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 3-amino-5,6-difluoro-2-piperidin-4-yl-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 67025239 |
| Molecular Formula | C15H23F2N3O2 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | tert-butyl 3-amino-5,6-difluoro-2-piperidin-4-yl-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(F)=C(F)C=C(N)C1C1CCNCC1 |
| InChI | InChI=1S/C15H23F2N3O2/c1-15(2,3)22-14(21)20-12(9-4-6-19-7-5-9)11(18)8-10(16)13(20)17/h8-9,12,19H,4-7,18H2,1-3H3 |
| InChIKey | OSESIGGHRXRITI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|