C28H42FN5O7 — CID 67025364
(3S,5R)-3-[[2-[4-fluoro-2-(4-methoxybutylamino)anilino]-2-oxoacetyl]-(2-methylpropyl)amino]-5-(morpholine-4-carbonyl)piperidine-1-carboxylic acid (PubChem CID 67025364) has the molecular formula C28H42FN5O7 and a molecular weight of 579.67 g/mol. Its IUPAC name is (3S,5R)-3-[[2-[4-fluoro-2-(4-methoxybutylamino)anilino]-2-oxoacetyl]-(2-methylpropyl)amino]-5-(morpholine-4-carbonyl)piperidine-1-carboxylic acid.
| Compound Name | (3S,5R)-3-[[2-[4-fluoro-2-(4-methoxybutylamino)anilino]-2-oxoacetyl]-(2-methylpropyl)amino]-5-(morpholine-4-carbonyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67025364 |
| Molecular Formula | C28H42FN5O7 |
| Molecular Weight | 579.67 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | (3S,5R)-3-[[2-[4-fluoro-2-(4-methoxybutylamino)anilino]-2-oxoacetyl]-(2-methylpropyl)amino]-5-(morpholine-4-carbonyl)piperidine-1-carboxylic acid |
| SMILES | COCCCCNc1cc(F)ccc1NC(=O)C(=O)N(CC(C)C)[C@H]1C[C@@H](C(=O)N2CCOCC2)CN(C(=O)O)C1 |
| InChI | InChI=1S/C28H42FN5O7/c1-19(2)16-34(22-14-20(17-33(18-22)28(38)39)26(36)32-9-12-41-13-10-32)27(37)25(35)31-23-7-6-21(29)15-24(23)30-8-4-5-11-40-3/h6-7,15,19-20,22,30H,4-5,8-14,16-18H2,1-3H3,(H,31,35)(H,38,39)/t20-,22+/m1/s1 |
| InChIKey | QUVYNIYELRKGSA-IRLDBZIGSA-N |
| XLogP | 2.31 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.67 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|