About ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate
ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate (PubChem CID 67025539) has the molecular formula C9H11NO4S
and a molecular weight of 229.26 g/mol. Its IUPAC name is ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate |
| PubChem CID | 67025539 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(COC(C)=O)cs1 |
| InChI | InChI=1S/C9H11NO4S/c1-3-13-9(12)8-10-7(5-15-8)4-14-6(2)11/h5H,3-4H2,1-2H3 |
| InChIKey | QDKJAECLHVQFHL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate?
The IUPAC name of ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate (CID 67025539) is ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate.
What is the SMILES notation for ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate?
The canonical SMILES for ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate is CCOC(=O)c1nc(COC(C)=O)cs1.
What is the InChIKey of ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate?
The InChIKey is QDKJAECLHVQFHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4S/c1-3-13-9(12)8-10-7(5-15-8)4-14-6(2)11/h5H,3-4H2,1-2H3.
What are the key properties of ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate?
ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate has a molecular weight of 229.26 g/mol, XLogP of 1.38, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(acetyloxymethyl)-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 67025539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).