C14H22N2O2S — CID 67026221
4-[3-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yloxy)propyl]morpholine (PubChem CID 67026221) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 4-[3-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yloxy)propyl]morpholine.
| Compound Name | 4-[3-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yloxy)propyl]morpholine |
|---|---|
| PubChem CID | 67026221 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-[3-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yloxy)propyl]morpholine |
| SMILES | c1c(OCCCN2CCOCC2)sc2c1CNCC2 |
| InChI | InChI=1S/C14H22N2O2S/c1(4-16-5-8-17-9-6-16)7-18-14-10-12-11-15-3-2-13(12)19-14/h10,15H,1-9,11H2 |
| InChIKey | LARFBZDDVKJUCV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|