C28H24N2O3 — CID 67026365
4-(oxan-2-yloxy)-3-[4-(quinolin-2-ylmethoxy)phenyl]benzonitrile (PubChem CID 67026365) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-(oxan-2-yloxy)-3-[4-(quinolin-2-ylmethoxy)phenyl]benzonitrile.
| Compound Name | 4-(oxan-2-yloxy)-3-[4-(quinolin-2-ylmethoxy)phenyl]benzonitrile |
|---|---|
| PubChem CID | 67026365 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 4-(oxan-2-yloxy)-3-[4-(quinolin-2-ylmethoxy)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(OC2CCCCO2)c(-c2ccc(OCc3ccc4ccccc4n3)cc2)c1 |
| InChI | InChI=1S/C28H24N2O3/c29-18-20-8-15-27(33-28-7-3-4-16-31-28)25(17-20)21-10-13-24(14-11-21)32-19-23-12-9-22-5-1-2-6-26(22)30-23/h1-2,5-6,8-15,17,28H,3-4,7,16,19H2 |
| InChIKey | DYDKBUGHBNBJIK-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |