About 2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine
2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine (PubChem CID 67026392) has the molecular formula C23H24N4
and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine.
Molecular Properties
| Compound Name | 2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine |
| PubChem CID | 67026392 |
| Molecular Formula | C23H24N4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine |
| SMILES | CC(Nc1nc2ccccc2c2nc(C3CCCC3)[nH]c12)c1ccccc1 |
| InChI | InChI=1S/C23H24N4/c1-15(16-9-3-2-4-10-16)24-23-21-20(18-13-7-8-14-19(18)25-23)26-22(27-21)17-11-5-6-12-17/h2-4,7-10,13-15,17H,5-6,11-12H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | BQDWAEMHGRRAQA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine?
The IUPAC name of 2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine (CID 67026392) is 2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine.
What is the SMILES notation for 2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine?
The canonical SMILES for 2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine is CC(Nc1nc2ccccc2c2nc(C3CCCC3)[nH]c12)c1ccccc1.
What is the InChIKey of 2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine?
The InChIKey is BQDWAEMHGRRAQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4/c1-15(16-9-3-2-4-10-16)24-23-21-20(18-13-7-8-14-19(18)25-23)26-22(27-21)17-11-5-6-12-17/h2-4,7-10,13-15,17H,5-6,11-12H2,1H3,(H,24,25)(H,26,27).
What are the key properties of 2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine?
2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine has a molecular weight of 356.47 g/mol, XLogP of 5.94, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-N-(1-phenylethyl)-3H-imidazo[4,5-c]quinolin-4-amine is sourced from PubChem (CID 67026392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).