C34H30Cl3N5O4S — CID 6702644
2,2,2-trichloro-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6702644) has the molecular formula C34H30Cl3N5O4S and a molecular weight of 711.07 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6702644 |
| Molecular Formula | C34H30Cl3N5O4S |
| Molecular Weight | 711.07 g/mol |
| Exact Mass | 709.11 |
| IUPAC Name | 2,2,2-trichloro-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | O=C(NCc1ccccc1-c1ccc([C@H]2O[C@@H](CSc3nnnn3-c3ccccc3)C[C@@H](c3ccc(CO)cc3)O2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C34H30Cl3N5O4S/c35-34(36,37)32(44)38-19-26-6-4-5-9-29(26)23-14-16-25(17-15-23)31-45-28(18-30(46-31)24-12-10-22(20-43)11-13-24)21-47-33-39-40-41-42(33)27-7-2-1-3-8-27/h1-17,28,30-31,43H,18-21H2,(H,38,44)/t28-,30+,31+/m1/s1 |
| InChIKey | MUJIJCBJHFLUEX-LMERMFHRSA-N |
| XLogP | 7.15 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.07 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|