About 4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate
4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate (PubChem CID 67026911) has the molecular formula C22H36O9
and a molecular weight of 444.52 g/mol. Its IUPAC name is 4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate.
Molecular Properties
| Compound Name | 4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate |
| PubChem CID | 67026911 |
| Molecular Formula | C22H36O9 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate |
| SMILES | CC(=O)OCC(COC(=O)CC(C)(O)C(=O)OC1CC(C)CCC1C(C)C)OC(C)=O |
| InChI | InChI=1S/C22H36O9/c1-13(2)18-8-7-14(3)9-19(18)31-21(26)22(6,27)10-20(25)29-12-17(30-16(5)24)11-28-15(4)23/h13-14,17-19,27H,7-12H2,1-6H3 |
| InChIKey | XHYVXGAFRWHNLF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate?
The IUPAC name of 4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate (CID 67026911) is 4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate.
What is the SMILES notation for 4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate?
The canonical SMILES for 4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate is CC(=O)OCC(COC(=O)CC(C)(O)C(=O)OC1CC(C)CCC1C(C)C)OC(C)=O.
What is the InChIKey of 4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate?
The InChIKey is XHYVXGAFRWHNLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36O9/c1-13(2)18-8-7-14(3)9-19(18)31-21(26)22(6,27)10-20(25)29-12-17(30-16(5)24)11-28-15(4)23/h13-14,17-19,27H,7-12H2,1-6H3.
What are the key properties of 4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate?
4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate has a molecular weight of 444.52 g/mol, XLogP of 2.17, 10 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2,3-diacetyloxypropyl) 1-O-(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxy-2-methylbutanedioate is sourced from PubChem (CID 67026911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).