About [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate
[3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate (PubChem CID 67027046) has the molecular formula C29H34FNO2
and a molecular weight of 447.59 g/mol. Its IUPAC name is [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate.
Molecular Properties
| Compound Name | [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate |
| PubChem CID | 67027046 |
| Molecular Formula | C29H34FNO2 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate |
| SMILES | CC[C@@H](c1cccc(OC(=O)C(C)c2ccc(-c3ccccc3)c(F)c2)c1)[C@@H](C)CN(C)C |
| InChI | InChI=1S/C29H34FNO2/c1-6-26(20(2)19-31(4)5)24-13-10-14-25(17-24)33-29(32)21(3)23-15-16-27(28(30)18-23)22-11-8-7-9-12-22/h7-18,20-21,26H,6,19H2,1-5H3/t20-,21?,26+/m0/s1 |
| InChIKey | IDDJPDLKWQKTEG-MPXHWGBGSA-N |
| XLogP | 6.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate?
The IUPAC name of [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate (CID 67027046) is [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate.
What is the SMILES notation for [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate?
The canonical SMILES for [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate is CC[C@@H](c1cccc(OC(=O)C(C)c2ccc(-c3ccccc3)c(F)c2)c1)[C@@H](C)CN(C)C.
What is the InChIKey of [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate?
The InChIKey is IDDJPDLKWQKTEG-MPXHWGBGSA-N. The full InChI is InChI=1S/C29H34FNO2/c1-6-26(20(2)19-31(4)5)24-13-10-14-25(17-24)33-29(32)21(3)23-15-16-27(28(30)18-23)22-11-8-7-9-12-22/h7-18,20-21,26H,6,19H2,1-5H3/t20-,21?,26+/m0/s1.
What are the key properties of [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate?
[3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate has a molecular weight of 447.59 g/mol, XLogP of 6.89, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate is sourced from PubChem (CID 67027046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).