C24H26BN3O3 — CID 67027532
3-[2-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]-3,4-dihydropyrazol-5-yl]benzonitrile (PubChem CID 67027532) has the molecular formula C24H26BN3O3 and a molecular weight of 415.30 g/mol. Its IUPAC name is 3-[2-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]-3,4-dihydropyrazol-5-yl]benzonitrile.
| Compound Name | 3-[2-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]-3,4-dihydropyrazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 67027532 |
| Molecular Formula | C24H26BN3O3 |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 3-[2-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]-3,4-dihydropyrazol-5-yl]benzonitrile |
| SMILES | CC1(C)OB(c2cccc(CC(=O)N3CCC(c4cccc(C#N)c4)=N3)c2)OC1(C)C |
| InChI | InChI=1S/C24H26BN3O3/c1-23(2)24(3,4)31-25(30-23)20-10-6-7-17(14-20)15-22(29)28-12-11-21(27-28)19-9-5-8-18(13-19)16-26/h5-10,13-14H,11-12,15H2,1-4H3 |
| InChIKey | LJHODWLVVFNKGG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|