About 2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol
2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol (PubChem CID 67028125) has the molecular formula C24H18FNO3
and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol.
Molecular Properties
| Compound Name | 2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol |
| PubChem CID | 67028125 |
| Molecular Formula | C24H18FNO3 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol |
| SMILES | Cn1cc(C=C2Cc3c(O)cc(O)cc3O2)c2c(-c3cccc(F)c3)cccc21 |
| InChI | InChI=1S/C24H18FNO3/c1-26-13-15(9-18-12-20-22(28)10-17(27)11-23(20)29-18)24-19(6-3-7-21(24)26)14-4-2-5-16(25)8-14/h2-11,13,27-28H,12H2,1H3 |
| InChIKey | VYZYBYSOLZMSLA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol?
The IUPAC name of 2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol (CID 67028125) is 2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol.
What is the SMILES notation for 2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol?
The canonical SMILES for 2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol is Cn1cc(C=C2Cc3c(O)cc(O)cc3O2)c2c(-c3cccc(F)c3)cccc21.
What is the InChIKey of 2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol?
The InChIKey is VYZYBYSOLZMSLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18FNO3/c1-26-13-15(9-18-12-20-22(28)10-17(27)11-23(20)29-18)24-19(6-3-7-21(24)26)14-4-2-5-16(25)8-14/h2-11,13,27-28H,12H2,1H3.
What are the key properties of 2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol?
2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol has a molecular weight of 387.41 g/mol, XLogP of 5.37, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(3-fluorophenyl)-1-methylindol-3-yl]methylidene]-3H-1-benzofuran-4,6-diol is sourced from PubChem (CID 67028125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).