C5H9NOS — CID 67028649
(3aS)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c]oxathiazole (PubChem CID 67028649) has the molecular formula C5H9NOS and a molecular weight of 131.20 g/mol. Its IUPAC name is (3aS)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c]oxathiazole.
| Compound Name | (3aS)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c]oxathiazole |
|---|---|
| PubChem CID | 67028649 |
| Molecular Formula | C5H9NOS |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | (3aS)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c]oxathiazole |
| SMILES | C1C[C@H]2COSN2C1 |
| InChI | InChI=1S/C5H9NOS/c1-2-5-4-7-8-6(5)3-1/h5H,1-4H2/t5-/m0/s1 |
| InChIKey | QONWYEBYAROWCX-YFKPBYRVSA-N |
| XLogP | 1.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|