C33H39F2N9O3 — CID 67028950
1-[4-[4,6-bis[(1S,5S,6R)-6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]-1,3,5-triazin-2-yl]phenyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea (PubChem CID 67028950) has the molecular formula C33H39F2N9O3 and a molecular weight of 647.73 g/mol. Its IUPAC name is 1-[4-[4,6-bis[(1S,5S,6R)-6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]-1,3,5-triazin-2-yl]phenyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-[4-[4,6-bis[(1S,5S,6R)-6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]-1,3,5-triazin-2-yl]phenyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 67028950 |
| Molecular Formula | C33H39F2N9O3 |
| Molecular Weight | 647.73 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | 1-[4-[4,6-bis[(1S,5S,6R)-6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]-1,3,5-triazin-2-yl]phenyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea |
| SMILES | CN1CCN(c2ccc(NC(=O)Nc3ccc(-c4nc(N5[C@@H]6COC[C@H]5[C@H](F)C6)nc(N5[C@@H]6COC[C@H]5[C@H](F)C6)n4)cc3)cc2)CC1 |
| InChI | InChI=1S/C33H39F2N9O3/c1-41-10-12-42(13-11-41)23-8-6-22(7-9-23)37-33(45)36-21-4-2-20(3-5-21)30-38-31(43-24-14-26(34)28(43)18-46-16-24)40-32(39-30)44-25-15-27(35)29(44)19-47-17-25/h2-9,24-29H,10-19H2,1H3,(H2,36,37,45)/t24-,25-,26+,27+,28-,29-/m0/s1 |
| InChIKey | VPAXTDXSSUHERT-LYVCBSGGSA-N |
| XLogP | 3.57 |
| TPSA | 111.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|