About N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride
N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride (PubChem CID 67029054) has the molecular formula C9H20Cl2F3N3O2S
and a molecular weight of 362.25 g/mol. Its IUPAC name is N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride.
Molecular Properties
| Compound Name | N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride |
| PubChem CID | 67029054 |
| Molecular Formula | C9H20Cl2F3N3O2S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride |
| SMILES | Cl.Cl.NCC1CCN(CCNS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H18F3N3O2S.2ClH/c10-9(11,12)18(16,17)14-3-6-15-4-1-8(7-13)2-5-15;;/h8,14H,1-7,13H2;2*1H |
| InChIKey | NBOORXWLXGYLMO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride?
The IUPAC name of N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride (CID 67029054) is N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride.
What is the SMILES notation for N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride?
The canonical SMILES for N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride is Cl.Cl.NCC1CCN(CCNS(=O)(=O)C(F)(F)F)CC1.
What is the InChIKey of N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride?
The InChIKey is NBOORXWLXGYLMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3N3O2S.2ClH/c10-9(11,12)18(16,17)14-3-6-15-4-1-8(7-13)2-5-15;;/h8,14H,1-7,13H2;2*1H.
What are the key properties of N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride?
N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride has a molecular weight of 362.25 g/mol, XLogP of 0.94, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-(aminomethyl)piperidin-1-yl]ethyl]-1,1,1-trifluoromethanesulfonamide;dihydrochloride is sourced from PubChem (CID 67029054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).