About 4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide
4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 67029058) has the molecular formula C20H15N5O2
and a molecular weight of 357.37 g/mol. Its IUPAC name is 4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 67029058 |
| Molecular Formula | C20H15N5O2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1onc(C(N)=O)c1-c1cc(-c2cccc3[nH]ccc23)cc2[nH]ncc12 |
| InChI | InChI=1S/C20H15N5O2/c1-10-18(19(20(21)26)25-27-10)14-7-11(8-17-15(14)9-23-24-17)12-3-2-4-16-13(12)5-6-22-16/h2-9,22H,1H3,(H2,21,26)(H,23,24) |
| InChIKey | GAAMIGWKBHVYAM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide?
The IUPAC name of 4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide (CID 67029058) is 4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for 4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide is Cc1onc(C(N)=O)c1-c1cc(-c2cccc3[nH]ccc23)cc2[nH]ncc12.
What is the InChIKey of 4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide?
The InChIKey is GAAMIGWKBHVYAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N5O2/c1-10-18(19(20(21)26)25-27-10)14-7-11(8-17-15(14)9-23-24-17)12-3-2-4-16-13(12)5-6-22-16/h2-9,22H,1H3,(H2,21,26)(H,23,24).
What are the key properties of 4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide?
4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide has a molecular weight of 357.37 g/mol, XLogP of 3.77, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 67029058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).