C36H41F2N9O4 — CID 67029167
1-[4-[4,6-bis[(1S,5S,6R)-6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]-1,3,5-triazin-2-yl]phenyl]-3-[4-(4-cyclopropylpiperazine-1-carbonyl)phenyl]urea (PubChem CID 67029167) has the molecular formula C36H41F2N9O4 and a molecular weight of 701.78 g/mol. Its IUPAC name is 1-[4-[4,6-bis[(1S,5S,6R)-6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]-1,3,5-triazin-2-yl]phenyl]-3-[4-(4-cyclopropylpiperazine-1-carbonyl)phenyl]urea.
| Compound Name | 1-[4-[4,6-bis[(1S,5S,6R)-6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]-1,3,5-triazin-2-yl]phenyl]-3-[4-(4-cyclopropylpiperazine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 67029167 |
| Molecular Formula | C36H41F2N9O4 |
| Molecular Weight | 701.78 g/mol |
| Exact Mass | 701.32 |
| IUPAC Name | 1-[4-[4,6-bis[(1S,5S,6R)-6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]-1,3,5-triazin-2-yl]phenyl]-3-[4-(4-cyclopropylpiperazine-1-carbonyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(=O)N2CCN(C3CC3)CC2)cc1)Nc1ccc(-c2nc(N3[C@@H]4COC[C@H]3[C@H](F)C4)nc(N3[C@@H]4COC[C@H]3[C@H](F)C4)n2)cc1 |
| InChI | InChI=1S/C36H41F2N9O4/c37-28-15-26-17-50-19-30(28)46(26)34-41-32(42-35(43-34)47-27-16-29(38)31(47)20-51-18-27)21-1-5-23(6-2-21)39-36(49)40-24-7-3-22(4-8-24)33(48)45-13-11-44(12-14-45)25-9-10-25/h1-8,25-31H,9-20H2,(H2,39,40,49)/t26-,27-,28+,29+,30-,31-/m0/s1 |
| InChIKey | GYIRMCNMZCSTJI-ZAFXZDQFSA-N |
| XLogP | 3.73 |
| TPSA | 128.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |