C21H18Cl2N4O — CID 67029287
N',3-bis(4-chlorophenyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carbohydrazide (PubChem CID 67029287) has the molecular formula C21H18Cl2N4O and a molecular weight of 413.31 g/mol. Its IUPAC name is N',3-bis(4-chlorophenyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carbohydrazide.
| Compound Name | N',3-bis(4-chlorophenyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carbohydrazide |
|---|---|
| PubChem CID | 67029287 |
| Molecular Formula | C21H18Cl2N4O |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N',3-bis(4-chlorophenyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carbohydrazide |
| SMILES | O=C(NNc1ccc(Cl)cc1)c1nn(-c2ccc(Cl)cc2)c2c1C1CCC2C1 |
| InChI | InChI=1S/C21H18Cl2N4O/c22-14-3-7-16(8-4-14)24-25-21(28)19-18-12-1-2-13(11-12)20(18)27(26-19)17-9-5-15(23)6-10-17/h3-10,12-13,24H,1-2,11H2,(H,25,28) |
| InChIKey | RJXVAWAZHPLMON-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|