C21H20N4O — CID 67029678
N',3-diphenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carbohydrazide (PubChem CID 67029678) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is N',3-diphenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carbohydrazide.
| Compound Name | N',3-diphenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carbohydrazide |
|---|---|
| PubChem CID | 67029678 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N',3-diphenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carbohydrazide |
| SMILES | O=C(NNc1ccccc1)c1nn(-c2ccccc2)c2c1C1CCC2C1 |
| InChI | InChI=1S/C21H20N4O/c26-21(23-22-16-7-3-1-4-8-16)19-18-14-11-12-15(13-14)20(18)25(24-19)17-9-5-2-6-10-17/h1-10,14-15,22H,11-13H2,(H,23,26) |
| InChIKey | XYVAKBDAABICRV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|