C24H22Cl2N2O6 — CID 67030970
N-benzyl-2-[6-[2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)acetyl]-2,3-dimethoxyphenoxy]acetamide (PubChem CID 67030970) has the molecular formula C24H22Cl2N2O6 and a molecular weight of 505.35 g/mol. Its IUPAC name is N-benzyl-2-[6-[2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)acetyl]-2,3-dimethoxyphenoxy]acetamide.
| Compound Name | N-benzyl-2-[6-[2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)acetyl]-2,3-dimethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 67030970 |
| Molecular Formula | C24H22Cl2N2O6 |
| Molecular Weight | 505.35 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | N-benzyl-2-[6-[2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)acetyl]-2,3-dimethoxyphenoxy]acetamide |
| SMILES | COc1ccc(C(=O)Cc2c(Cl)c[n+]([O-])cc2Cl)c(OCC(=O)NCc2ccccc2)c1OC |
| InChI | InChI=1S/C24H22Cl2N2O6/c1-32-21-9-8-16(20(29)10-17-18(25)12-28(31)13-19(17)26)23(24(21)33-2)34-14-22(30)27-11-15-6-4-3-5-7-15/h3-9,12-13H,10-11,14H2,1-2H3,(H,27,30) |
| InChIKey | BUBCALVPRCXCJV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|