About methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate
methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate (PubChem CID 67031026) has the molecular formula C23H27FN2O2
and a molecular weight of 382.48 g/mol. Its IUPAC name is methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate.
Molecular Properties
| Compound Name | methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate |
| PubChem CID | 67031026 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate |
| SMILES | C=CC[C@@]1(N(C(=O)OC)c2ccccc2)CCN[C@H](c2ccc(F)cc2C)C1 |
| InChI | InChI=1S/C23H27FN2O2/c1-4-12-23(26(22(27)28-3)19-8-6-5-7-9-19)13-14-25-21(16-23)20-11-10-18(24)15-17(20)2/h4-11,15,21,25H,1,12-14,16H2,2-3H3/t21-,23+/m0/s1 |
| InChIKey | UMRNNIQFZRISBI-JTHBVZDNSA-N |
| XLogP | 5.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate?
The IUPAC name of methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate (CID 67031026) is methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate.
What is the SMILES notation for methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate?
The canonical SMILES for methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate is C=CC[C@@]1(N(C(=O)OC)c2ccccc2)CCN[C@H](c2ccc(F)cc2C)C1.
What is the InChIKey of methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate?
The InChIKey is UMRNNIQFZRISBI-JTHBVZDNSA-N. The full InChI is InChI=1S/C23H27FN2O2/c1-4-12-23(26(22(27)28-3)19-8-6-5-7-9-19)13-14-25-21(16-23)20-11-10-18(24)15-17(20)2/h4-11,15,21,25H,1,12-14,16H2,2-3H3/t21-,23+/m0/s1.
What are the key properties of methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate?
methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate has a molecular weight of 382.48 g/mol, XLogP of 5.15, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(2S,4R)-2-(4-fluoro-2-methylphenyl)-4-prop-2-enylpiperidin-4-yl]-N-phenylcarbamate is sourced from PubChem (CID 67031026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).