C8H13NO2 — CID 67031714
6-amino-6-(methoxymethyl)cyclohexa-2,4-dien-1-ol (PubChem CID 67031714) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 6-amino-6-(methoxymethyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 6-amino-6-(methoxymethyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 67031714 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 6-amino-6-(methoxymethyl)cyclohexa-2,4-dien-1-ol |
| SMILES | COCC1(N)C=CC=CC1O |
| InChI | InChI=1S/C8H13NO2/c1-11-6-8(9)5-3-2-4-7(8)10/h2-5,7,10H,6,9H2,1H3 |
| InChIKey | AHBYUYHELCOFLX-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |