About 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride
3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride (PubChem CID 67032572) has the molecular formula C20H21Cl3FNO4
and a molecular weight of 464.75 g/mol. Its IUPAC name is 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride |
| PubChem CID | 67032572 |
| Molecular Formula | C20H21Cl3FNO4 |
| Molecular Weight | 464.75 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCN1CCOC(c2ccc(OCc3c(Cl)cccc3Cl)cc2F)C1 |
| InChI | InChI=1S/C20H20Cl2FNO4.ClH/c21-16-2-1-3-17(22)15(16)12-28-13-4-5-14(18(23)10-13)19-11-24(8-9-27-19)7-6-20(25)26;/h1-5,10,19H,6-9,11-12H2,(H,25,26);1H |
| InChIKey | SOIPAXHPZMPVGK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.75 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride?
The IUPAC name of 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride (CID 67032572) is 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride.
What is the SMILES notation for 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride?
The canonical SMILES for 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride is Cl.O=C(O)CCN1CCOC(c2ccc(OCc3c(Cl)cccc3Cl)cc2F)C1.
What is the InChIKey of 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride?
The InChIKey is SOIPAXHPZMPVGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20Cl2FNO4.ClH/c21-16-2-1-3-17(22)15(16)12-28-13-4-5-14(18(23)10-13)19-11-24(8-9-27-19)7-6-20(25)26;/h1-5,10,19H,6-9,11-12H2,(H,25,26);1H.
What are the key properties of 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride?
3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride has a molecular weight of 464.75 g/mol, XLogP of 4.98, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-2-fluorophenyl]morpholin-4-yl]propanoic acid;hydrochloride is sourced from PubChem (CID 67032572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).