C24H34ClNO7 — CID 67033352
tert-butyl (2R,3R)-2,3-diacetyloxy-4-[4-tert-butyl-N-(2-chloroethyl)anilino]-4-oxobutanoate (PubChem CID 67033352) has the molecular formula C24H34ClNO7 and a molecular weight of 483.99 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2,3-diacetyloxy-4-[4-tert-butyl-N-(2-chloroethyl)anilino]-4-oxobutanoate.
| Compound Name | tert-butyl (2R,3R)-2,3-diacetyloxy-4-[4-tert-butyl-N-(2-chloroethyl)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 67033352 |
| Molecular Formula | C24H34ClNO7 |
| Molecular Weight | 483.99 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | tert-butyl (2R,3R)-2,3-diacetyloxy-4-[4-tert-butyl-N-(2-chloroethyl)anilino]-4-oxobutanoate |
| SMILES | CC(=O)O[C@@H](C(=O)OC(C)(C)C)[C@@H](OC(C)=O)C(=O)N(CCCl)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H34ClNO7/c1-15(27)31-19(20(32-16(2)28)22(30)33-24(6,7)8)21(29)26(14-13-25)18-11-9-17(10-12-18)23(3,4)5/h9-12,19-20H,13-14H2,1-8H3/t19-,20-/m1/s1 |
| InChIKey | QHZIDQOKSMRIPF-WOJBJXKFSA-N |
| XLogP | 3.76 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.99 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|