C27H29FN8O3SSi — CID 67033359
(4S)-3-[3-[3-fluoro-4-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]pyrazolo[1,5-a]pyrimidin-5-yl]-4-(2-methyl-1,3-thiazol-4-yl)-1,3-oxazolidin-2-one (PubChem CID 67033359) has the molecular formula C27H29FN8O3SSi and a molecular weight of 592.73 g/mol. Its IUPAC name is (4S)-3-[3-[3-fluoro-4-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]pyrazolo[1,5-a]pyrimidin-5-yl]-4-(2-methyl-1,3-thiazol-4-yl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[3-[3-fluoro-4-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]pyrazolo[1,5-a]pyrimidin-5-yl]-4-(2-methyl-1,3-thiazol-4-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67033359 |
| Molecular Formula | C27H29FN8O3SSi |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | (4S)-3-[3-[3-fluoro-4-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]pyrazolo[1,5-a]pyrimidin-5-yl]-4-(2-methyl-1,3-thiazol-4-yl)-1,3-oxazolidin-2-one |
| SMILES | Cc1nc([C@H]2COC(=O)N2c2ccn3ncc(-c4ccc(-c5ncn(COCC[Si](C)(C)C)n5)c(F)c4)c3n2)cs1 |
| InChI | InChI=1S/C27H29FN8O3SSi/c1-17-31-22(14-40-17)23-13-39-27(37)36(23)24-7-8-35-26(32-24)20(12-30-35)18-5-6-19(21(28)11-18)25-29-15-34(33-25)16-38-9-10-41(2,3)4/h5-8,11-12,14-15,23H,9-10,13,16H2,1-4H3/t23-/m1/s1 |
| InChIKey | LJXAVALXWFUPLQ-HSZRJFAPSA-N |
| XLogP | 5.57 |
| TPSA | 112.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|