About Tert-butyl 3-(3-(4-(trifluoromethyl)phenylamino)phenyl)piperidine-1-carboxylate
Tert-butyl 3-(3-(4-(trifluoromethyl)phenylamino)phenyl)piperidine-1-carboxylate (PubChem CID 67033612) has the molecular formula C23H27F3N2O2
and a molecular weight of 420.50 g/mol. Its IUPAC name is tert-butyl 3-[3-[4-(trifluoromethyl)anilino]phenyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | Tert-butyl 3-(3-(4-(trifluoromethyl)phenylamino)phenyl)piperidine-1-carboxylate |
| PubChem CID | 67033612 |
| Molecular Formula | C23H27F3N2O2 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | tert-butyl 3-[3-[4-(trifluoromethyl)anilino]phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)C2=CC(=CC=C2)NC3=CC=C(C=C3)C(F)(F)F |
| InChI | InChI=1S/C23H27F3N2O2/c1-22(2,3)30-21(29)28-13-5-7-17(15-28)16-6-4-8-20(14-16)27-19-11-9-18(10-12-19)23(24,25)26/h4,6,8-12,14,17,27H,5,7,13,15H2,1-3H3 |
| InChIKey | RLVBPFMWLLSZDJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 41.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | 568 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze Tert-butyl 3-(3-(4-(trifluoromethyl)phenylamino)phenyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tert-butyl 3-(3-(4-(trifluoromethyl)phenylamino)phenyl)piperidine-1-carboxylate?
The IUPAC name of Tert-butyl 3-(3-(4-(trifluoromethyl)phenylamino)phenyl)piperidine-1-carboxylate (CID 67033612) is tert-butyl 3-[3-[4-(trifluoromethyl)anilino]phenyl]piperidine-1-carboxylate.
What is the SMILES notation for Tert-butyl 3-(3-(4-(trifluoromethyl)phenylamino)phenyl)piperidine-1-carboxylate?
The canonical SMILES for Tert-butyl 3-(3-(4-(trifluoromethyl)phenylamino)phenyl)piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCCC(C1)C2=CC(=CC=C2)NC3=CC=C(C=C3)C(F)(F)F.
What is the InChIKey of Tert-butyl 3-(3-(4-(trifluoromethyl)phenylamino)phenyl)piperidine-1-carboxylate?
The InChIKey is RLVBPFMWLLSZDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27F3N2O2/c1-22(2,3)30-21(29)28-13-5-7-17(15-28)16-6-4-8-20(14-16)27-19-11-9-18(10-12-19)23(24,25)26/h4,6,8-12,14,17,27H,5,7,13,15H2,1-3H3.
What are the key properties of Tert-butyl 3-(3-(4-(trifluoromethyl)phenylamino)phenyl)piperidine-1-carboxylate?
Tert-butyl 3-(3-(4-(trifluoromethyl)phenylamino)phenyl)piperidine-1-carboxylate has a molecular weight of 420.50 g/mol, XLogP of 5.80, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Tert-butyl 3-(3-(4-(trifluoromethyl)phenylamino)phenyl)piperidine-1-carboxylate is sourced from PubChem (CID 67033612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).