About (3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane
(3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane (PubChem CID 67034098) has the molecular formula C12H10F3NO3
and a molecular weight of 273.21 g/mol. Its IUPAC name is (3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane.
Molecular Properties
| Compound Name | (3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane |
| PubChem CID | 67034098 |
| Molecular Formula | C12H10F3NO3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane |
| SMILES | C=C1COC(c2cc(F)c(F)cc2F)[C@@H]([N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H10F3NO3/c1-6-2-11(16(17)18)12(19-5-6)7-3-9(14)10(15)4-8(7)13/h3-4,11-12H,1-2,5H2/t11-,12?/m0/s1 |
| InChIKey | KPSCJXZYOCIAHZ-PXYINDEMSA-N |
| XLogP | 2.77 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane?
The IUPAC name of (3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane (CID 67034098) is (3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane.
What is the SMILES notation for (3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane?
The canonical SMILES for (3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane is C=C1COC(c2cc(F)c(F)cc2F)[C@@H]([N+](=O)[O-])C1.
What is the InChIKey of (3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane?
The InChIKey is KPSCJXZYOCIAHZ-PXYINDEMSA-N. The full InChI is InChI=1S/C12H10F3NO3/c1-6-2-11(16(17)18)12(19-5-6)7-3-9(14)10(15)4-8(7)13/h3-4,11-12H,1-2,5H2/t11-,12?/m0/s1.
What are the key properties of (3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane?
(3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane has a molecular weight of 273.21 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-methylidene-3-nitro-2-(2,4,5-trifluorophenyl)oxane is sourced from PubChem (CID 67034098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).