About 3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine
3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 67034454) has the molecular formula C7H9N5O
and a molecular weight of 179.18 g/mol. Its IUPAC name is 3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 67034454 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCOc1n[nH]c2ncnc(N)c12 |
| InChI | InChI=1S/C7H9N5O/c1-2-13-7-4-5(8)9-3-10-6(4)11-12-7/h3H,2H2,1H3,(H3,8,9,10,11,12) |
| InChIKey | WTCMHYKMFWOYQI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine (CID 67034454) is 3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine is CCOc1n[nH]c2ncnc(N)c12.
What is the InChIKey of 3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is WTCMHYKMFWOYQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O/c1-2-13-7-4-5(8)9-3-10-6(4)11-12-7/h3H,2H2,1H3,(H3,8,9,10,11,12).
What are the key properties of 3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine?
3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 179.18 g/mol, XLogP of 0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-1H-pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 67034454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).