About 5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine
5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 67035180) has the molecular formula C18H14ClN5O2
and a molecular weight of 367.80 g/mol. Its IUPAC name is 5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 67035180 |
| Molecular Formula | C18H14ClN5O2 |
| Molecular Weight | 367.80 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | CCc1[nH]c2nc(Oc3cccnc3)nc(Oc3cccnc3)c2c1Cl |
| InChI | InChI=1S/C18H14ClN5O2/c1-2-13-15(19)14-16(22-13)23-18(26-12-6-4-8-21-10-12)24-17(14)25-11-5-3-7-20-9-11/h3-10H,2H2,1H3,(H,22,23,24) |
| InChIKey | MZOFLKXSJCNXQF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine (CID 67035180) is 5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine is CCc1[nH]c2nc(Oc3cccnc3)nc(Oc3cccnc3)c2c1Cl.
What is the InChIKey of 5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is MZOFLKXSJCNXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClN5O2/c1-2-13-15(19)14-16(22-13)23-18(26-12-6-4-8-21-10-12)24-17(14)25-11-5-3-7-20-9-11/h3-10H,2H2,1H3,(H,22,23,24).
What are the key properties of 5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine?
5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 367.80 g/mol, XLogP of 4.55, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-ethyl-2,4-dipyridin-3-yloxy-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 67035180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).