C11H20FNO3 — CID 67035631
tert-butyl-[(1S,2S,4R)-2-fluoro-4-hydroxycyclohexyl]carbamic acid (PubChem CID 67035631) has the molecular formula C11H20FNO3 and a molecular weight of 233.28 g/mol. Its IUPAC name is tert-butyl-[(1S,2S,4R)-2-fluoro-4-hydroxycyclohexyl]carbamic acid.
| Compound Name | tert-butyl-[(1S,2S,4R)-2-fluoro-4-hydroxycyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 67035631 |
| Molecular Formula | C11H20FNO3 |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | tert-butyl-[(1S,2S,4R)-2-fluoro-4-hydroxycyclohexyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@H]1CC[C@@H](O)C[C@@H]1F |
| InChI | InChI=1S/C11H20FNO3/c1-11(2,3)13(10(15)16)9-5-4-7(14)6-8(9)12/h7-9,14H,4-6H2,1-3H3,(H,15,16)/t7-,8+,9+/m1/s1 |
| InChIKey | TXVYIRKHQVCNEF-VGMNWLOBSA-N |
| XLogP | 2.02 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |