About 3-propan-2-yltriazolo[4,5-b]pyridin-6-amine
3-propan-2-yltriazolo[4,5-b]pyridin-6-amine (PubChem CID 67036369) has the molecular formula C8H11N5
and a molecular weight of 177.21 g/mol. Its IUPAC name is 3-propan-2-yltriazolo[4,5-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 3-propan-2-yltriazolo[4,5-b]pyridin-6-amine |
| PubChem CID | 67036369 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 3-propan-2-yltriazolo[4,5-b]pyridin-6-amine |
| SMILES | CC(C)n1nnc2cc(N)cnc21 |
| InChI | InChI=1S/C8H11N5/c1-5(2)13-8-7(11-12-13)3-6(9)4-10-8/h3-5H,9H2,1-2H3 |
| InChIKey | ZSSBVCPOLHIGDN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-propan-2-yltriazolo[4,5-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yltriazolo[4,5-b]pyridin-6-amine?
The IUPAC name of 3-propan-2-yltriazolo[4,5-b]pyridin-6-amine (CID 67036369) is 3-propan-2-yltriazolo[4,5-b]pyridin-6-amine.
What is the SMILES notation for 3-propan-2-yltriazolo[4,5-b]pyridin-6-amine?
The canonical SMILES for 3-propan-2-yltriazolo[4,5-b]pyridin-6-amine is CC(C)n1nnc2cc(N)cnc21.
What is the InChIKey of 3-propan-2-yltriazolo[4,5-b]pyridin-6-amine?
The InChIKey is ZSSBVCPOLHIGDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5/c1-5(2)13-8-7(11-12-13)3-6(9)4-10-8/h3-5H,9H2,1-2H3.
What are the key properties of 3-propan-2-yltriazolo[4,5-b]pyridin-6-amine?
3-propan-2-yltriazolo[4,5-b]pyridin-6-amine has a molecular weight of 177.21 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yltriazolo[4,5-b]pyridin-6-amine is sourced from PubChem (CID 67036369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).