C19H21ClN4O — CID 67036408
1-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-2-pyrimidin-4-ylpropan-2-ol (PubChem CID 67036408) has the molecular formula C19H21ClN4O and a molecular weight of 356.86 g/mol. Its IUPAC name is 1-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-2-pyrimidin-4-ylpropan-2-ol.
| Compound Name | 1-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-2-pyrimidin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 67036408 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-2-pyrimidin-4-ylpropan-2-ol |
| SMILES | CN1CCc2c(n(CC(C)(O)c3ccncn3)c3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C19H21ClN4O/c1-19(25,18-5-7-21-12-22-18)11-24-16-4-3-13(20)9-15(16)14-6-8-23(2)10-17(14)24/h3-5,7,9,12,25H,6,8,10-11H2,1-2H3 |
| InChIKey | QOOOXPQVSTWNIW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|