C37H35N3O8 — CID 67036464
4-[4-[6-(5-carbamoyl-2-pyridinyl)-4-oxospiro[3H-chromene-2,4'-piperidine]-3-carbonyl]-2,6-diethoxyphenyl]benzoic acid (PubChem CID 67036464) has the molecular formula C37H35N3O8 and a molecular weight of 649.70 g/mol. Its IUPAC name is 4-[4-[6-(5-carbamoyl-2-pyridinyl)-4-oxospiro[3H-chromene-2,4'-piperidine]-3-carbonyl]-2,6-diethoxyphenyl]benzoic acid.
| Compound Name | 4-[4-[6-(5-carbamoyl-2-pyridinyl)-4-oxospiro[3H-chromene-2,4'-piperidine]-3-carbonyl]-2,6-diethoxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 67036464 |
| Molecular Formula | C37H35N3O8 |
| Molecular Weight | 649.70 g/mol |
| Exact Mass | 649.24 |
| IUPAC Name | 4-[4-[6-(5-carbamoyl-2-pyridinyl)-4-oxospiro[3H-chromene-2,4'-piperidine]-3-carbonyl]-2,6-diethoxyphenyl]benzoic acid |
| SMILES | CCOc1cc(C(=O)C2C(=O)c3cc(-c4ccc(C(N)=O)cn4)ccc3OC23CCNCC3)cc(OCC)c1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C37H35N3O8/c1-3-46-29-18-25(19-30(47-4-2)31(29)21-5-7-22(8-6-21)36(44)45)33(41)32-34(42)26-17-23(27-11-9-24(20-40-27)35(38)43)10-12-28(26)48-37(32)13-15-39-16-14-37/h5-12,17-20,32,39H,3-4,13-16H2,1-2H3,(H2,38,43)(H,44,45) |
| InChIKey | JVTHFJDENJJJLY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 167.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.70 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|