C22H23F3N4 — CID 67036629
4-methyl-8-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene (PubChem CID 67036629) has the molecular formula C22H23F3N4 and a molecular weight of 400.45 g/mol. Its IUPAC name is 4-methyl-8-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene.
| Compound Name | 4-methyl-8-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene |
|---|---|
| PubChem CID | 67036629 |
| Molecular Formula | C22H23F3N4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 4-methyl-8-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene |
| SMILES | Cc1cnc2c(c1)c1c(n2CCc2ccc(C(F)(F)F)nc2)CC2CCCN2C1 |
| InChI | InChI=1S/C22H23F3N4/c1-14-9-17-18-13-28-7-2-3-16(28)10-19(18)29(21(17)27-11-14)8-6-15-4-5-20(26-12-15)22(23,24)25/h4-5,9,11-12,16H,2-3,6-8,10,13H2,1H3 |
| InChIKey | GFHWQNPCMVWWPA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |