C21H21F3N4 — CID 67036634
8-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene (PubChem CID 67036634) has the molecular formula C21H21F3N4 and a molecular weight of 386.42 g/mol. Its IUPAC name is 8-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene.
| Compound Name | 8-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene |
|---|---|
| PubChem CID | 67036634 |
| Molecular Formula | C21H21F3N4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 8-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene |
| SMILES | FC(F)(F)c1ccc(CCn2c3c(c4cccnc42)CN2CCCC2C3)cn1 |
| InChI | InChI=1S/C21H21F3N4/c22-21(23,24)19-6-5-14(12-26-19)7-10-28-18-11-15-3-2-9-27(15)13-17(18)16-4-1-8-25-20(16)28/h1,4-6,8,12,15H,2-3,7,9-11,13H2 |
| InChIKey | IQBJPNGKXBNVRJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |