C10H14N2 — CID 67037119
2,5,5a,9a-tetrahydro-1-benzazepin-1-amine (PubChem CID 67037119) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2,5,5a,9a-tetrahydro-1-benzazepin-1-amine.
| Compound Name | 2,5,5a,9a-tetrahydro-1-benzazepin-1-amine |
|---|---|
| PubChem CID | 67037119 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2,5,5a,9a-tetrahydro-1-benzazepin-1-amine |
| SMILES | NN1CC=CCC2C=CC=CC21 |
| InChI | InChI=1S/C10H14N2/c11-12-8-4-3-6-9-5-1-2-7-10(9)12/h1-5,7,9-10H,6,8,11H2 |
| InChIKey | WMHPMZBTXPEYTH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|