About N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide
N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide (PubChem CID 67037464) has the molecular formula C8H10F2N2O2
and a molecular weight of 204.18 g/mol. Its IUPAC name is N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide |
| PubChem CID | 67037464 |
| Molecular Formula | C8H10F2N2O2 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide |
| SMILES | CCN(C(=O)C(F)F)c1cnoc1C |
| InChI | InChI=1S/C8H10F2N2O2/c1-3-12(8(13)7(9)10)6-4-11-14-5(6)2/h4,7H,3H2,1-2H3 |
| InChIKey | ORAQEVNGOQJREW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide?
The IUPAC name of N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide (CID 67037464) is N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide.
What is the SMILES notation for N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide?
The canonical SMILES for N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide is CCN(C(=O)C(F)F)c1cnoc1C.
What is the InChIKey of N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide?
The InChIKey is ORAQEVNGOQJREW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2O2/c1-3-12(8(13)7(9)10)6-4-11-14-5(6)2/h4,7H,3H2,1-2H3.
What are the key properties of N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide?
N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide has a molecular weight of 204.18 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,2-difluoro-N-(5-methyl-1,2-oxazol-4-yl)acetamide is sourced from PubChem (CID 67037464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).