About (2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide
(2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide (PubChem CID 67038911) has the molecular formula C11H11N3O2
and a molecular weight of 217.23 g/mol. Its IUPAC name is (2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide.
Molecular Properties
| Compound Name | (2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide |
| PubChem CID | 67038911 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | (2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide |
| SMILES | NC(=O)/C=C1\NCC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C11H11N3O2/c12-10(15)5-9-7-3-1-2-4-8(7)14-11(16)6-13-9/h1-5,13H,6H2,(H2,12,15)(H,14,16)/b9-5- |
| InChIKey | PTQRIUZDCRSPBI-UITAMQMPSA-N |
| XLogP | 0.05 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide?
The IUPAC name of (2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide (CID 67038911) is (2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide.
What is the SMILES notation for (2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide?
The canonical SMILES for (2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide is NC(=O)/C=C1\NCC(=O)Nc2ccccc21.
What is the InChIKey of (2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide?
The InChIKey is PTQRIUZDCRSPBI-UITAMQMPSA-N. The full InChI is InChI=1S/C11H11N3O2/c12-10(15)5-9-7-3-1-2-4-8(7)14-11(16)6-13-9/h1-5,13H,6H2,(H2,12,15)(H,14,16)/b9-5-.
What are the key properties of (2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide?
(2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide has a molecular weight of 217.23 g/mol, XLogP of 0.05, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(2-oxo-3,4-dihydro-1H-1,4-benzodiazepin-5-ylidene)acetamide is sourced from PubChem (CID 67038911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).