About (2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane
(2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 67039516) has the molecular formula C23H26Br2Si2
and a molecular weight of 518.44 g/mol. Its IUPAC name is (2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane.
Molecular Properties
| Compound Name | (2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane |
| PubChem CID | 67039516 |
| Molecular Formula | C23H26Br2Si2 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 515.99 |
| IUPAC Name | (2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | C[Si](C)(C)C1=CCC([Si](C)(C)C2c3cc(Br)ccc3-c3ccc(Br)cc32)=C1 |
| InChI | InChI=1S/C23H26Br2Si2/c1-26(2,3)17-8-9-18(14-17)27(4,5)23-21-12-15(24)6-10-19(21)20-11-7-16(25)13-22(20)23/h6-8,10-14,23H,9H2,1-5H3 |
| InChIKey | BQENLAPXKQHAKV-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane?
The IUPAC name of (2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane (CID 67039516) is (2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane.
What is the SMILES notation for (2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane?
The canonical SMILES for (2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane is C[Si](C)(C)C1=CCC([Si](C)(C)C2c3cc(Br)ccc3-c3ccc(Br)cc32)=C1.
What is the InChIKey of (2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane?
The InChIKey is BQENLAPXKQHAKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26Br2Si2/c1-26(2,3)17-8-9-18(14-17)27(4,5)23-21-12-15(24)6-10-19(21)20-11-7-16(25)13-22(20)23/h6-8,10-14,23H,9H2,1-5H3.
What are the key properties of (2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane?
(2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane has a molecular weight of 518.44 g/mol, XLogP of 8.24, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,7-dibromo-9H-fluoren-9-yl)-dimethyl-(3-trimethylsilylcyclopenta-1,3-dien-1-yl)silane is sourced from PubChem (CID 67039516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).