C36H36Br2 — CID 67039714
2,7-dibromo-9-[2-(3,6-ditert-butyl-9H-fluoren-9-yl)ethyl]-9H-fluorene (PubChem CID 67039714) has the molecular formula C36H36Br2 and a molecular weight of 628.49 g/mol. Its IUPAC name is 2,7-dibromo-9-[2-(3,6-ditert-butyl-9H-fluoren-9-yl)ethyl]-9H-fluorene.
| Compound Name | 2,7-dibromo-9-[2-(3,6-ditert-butyl-9H-fluoren-9-yl)ethyl]-9H-fluorene |
|---|---|
| PubChem CID | 67039714 |
| Molecular Formula | C36H36Br2 |
| Molecular Weight | 628.49 g/mol |
| Exact Mass | 626.12 |
| IUPAC Name | 2,7-dibromo-9-[2-(3,6-ditert-butyl-9H-fluoren-9-yl)ethyl]-9H-fluorene |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1cc(C(C)(C)C)ccc1C2CCC1c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C36H36Br2/c1-35(2,3)21-7-11-26-25(27-12-8-22(36(4,5)6)18-32(27)31(26)17-21)15-16-30-33-19-23(37)9-13-28(33)29-14-10-24(38)20-34(29)30/h7-14,17-20,25,30H,15-16H2,1-6H3 |
| InChIKey | FTDMFSOKTQUGHP-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.49 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |