About 1-adamantylboronic acid
1-adamantylboronic acid (PubChem CID 67039841) has the molecular formula C10H17BO2
and a molecular weight of 180.06 g/mol. Its IUPAC name is 1-adamantylboronic acid.
Molecular Properties
| Compound Name | 1-adamantylboronic acid |
| PubChem CID | 67039841 |
| Molecular Formula | C10H17BO2 |
| Molecular Weight | 180.06 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-adamantylboronic acid |
| SMILES | OB(O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H17BO2/c12-11(13)10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9,12-13H,1-6H2 |
| InChIKey | QGVQSUJPMRFLRO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.06 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylboronic acid?
The IUPAC name of 1-adamantylboronic acid (CID 67039841) is 1-adamantylboronic acid.
What is the SMILES notation for 1-adamantylboronic acid?
The canonical SMILES for 1-adamantylboronic acid is OB(O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantylboronic acid?
The InChIKey is QGVQSUJPMRFLRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17BO2/c12-11(13)10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9,12-13H,1-6H2.
What are the key properties of 1-adamantylboronic acid?
1-adamantylboronic acid has a molecular weight of 180.06 g/mol, XLogP of 1.43, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylboronic acid is sourced from PubChem (CID 67039841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).