About 2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene
2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene (PubChem CID 67040032) has the molecular formula C20H18S
and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene.
Molecular Properties
| Compound Name | 2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene |
| PubChem CID | 67040032 |
| Molecular Formula | C20H18S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene |
| SMILES | CC1=Cc2ccccc2C1CC1=CC(c2cccs2)=CC1 |
| InChI | InChI=1S/C20H18S/c1-14-11-16-5-2-3-6-18(16)19(14)13-15-8-9-17(12-15)20-7-4-10-21-20/h2-7,9-12,19H,8,13H2,1H3 |
| InChIKey | INGALFBGFUHQBS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene?
The IUPAC name of 2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene (CID 67040032) is 2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene.
What is the SMILES notation for 2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene?
The canonical SMILES for 2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene is CC1=Cc2ccccc2C1CC1=CC(c2cccs2)=CC1.
What is the InChIKey of 2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene?
The InChIKey is INGALFBGFUHQBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18S/c1-14-11-16-5-2-3-6-18(16)19(14)13-15-8-9-17(12-15)20-7-4-10-21-20/h2-7,9-12,19H,8,13H2,1H3.
What are the key properties of 2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene?
2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene has a molecular weight of 290.43 g/mol, XLogP of 6.05, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-methyl-1H-inden-1-yl)methyl]cyclopenta-1,4-dien-1-yl]thiophene is sourced from PubChem (CID 67040032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).