About hydroxylamine;4-piperidin-1-ylbutan-2-ol
hydroxylamine;4-piperidin-1-ylbutan-2-ol (PubChem CID 67040218) has the molecular formula C9H22N2O2
and a molecular weight of 190.29 g/mol. Its IUPAC name is hydroxylamine;4-piperidin-1-ylbutan-2-ol.
Molecular Properties
| Compound Name | hydroxylamine;4-piperidin-1-ylbutan-2-ol |
| PubChem CID | 67040218 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | hydroxylamine;4-piperidin-1-ylbutan-2-ol |
| SMILES | CC(O)CCN1CCCCC1.NO |
| InChI | InChI=1S/C9H19NO.H3NO/c1-9(11)5-8-10-6-3-2-4-7-10;1-2/h9,11H,2-8H2,1H3;2H,1H2 |
| InChIKey | ZCPPFDDTIVWCNT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxylamine;4-piperidin-1-ylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxylamine;4-piperidin-1-ylbutan-2-ol?
The IUPAC name of hydroxylamine;4-piperidin-1-ylbutan-2-ol (CID 67040218) is hydroxylamine;4-piperidin-1-ylbutan-2-ol.
What is the SMILES notation for hydroxylamine;4-piperidin-1-ylbutan-2-ol?
The canonical SMILES for hydroxylamine;4-piperidin-1-ylbutan-2-ol is CC(O)CCN1CCCCC1.NO.
What is the InChIKey of hydroxylamine;4-piperidin-1-ylbutan-2-ol?
The InChIKey is ZCPPFDDTIVWCNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.H3NO/c1-9(11)5-8-10-6-3-2-4-7-10;1-2/h9,11H,2-8H2,1H3;2H,1H2.
What are the key properties of hydroxylamine;4-piperidin-1-ylbutan-2-ol?
hydroxylamine;4-piperidin-1-ylbutan-2-ol has a molecular weight of 190.29 g/mol, XLogP of 0.58, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxylamine;4-piperidin-1-ylbutan-2-ol is sourced from PubChem (CID 67040218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).