About (2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine
(2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine (PubChem CID 67040292) has the molecular formula C13H11N5
and a molecular weight of 237.27 g/mol. Its IUPAC name is (2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine.
Molecular Properties
| Compound Name | (2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine |
| PubChem CID | 67040292 |
| Molecular Formula | C13H11N5 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine |
| SMILES | NNc1ccccc1-c1ncc2ncccc2n1 |
| InChI | InChI=1S/C13H11N5/c14-18-10-5-2-1-4-9(10)13-16-8-12-11(17-13)6-3-7-15-12/h1-8,18H,14H2 |
| InChIKey | CGVNYFAKRLRIPY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine?
The IUPAC name of (2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine (CID 67040292) is (2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine.
What is the SMILES notation for (2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine?
The canonical SMILES for (2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine is NNc1ccccc1-c1ncc2ncccc2n1.
What is the InChIKey of (2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine?
The InChIKey is CGVNYFAKRLRIPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N5/c14-18-10-5-2-1-4-9(10)13-16-8-12-11(17-13)6-3-7-15-12/h1-8,18H,14H2.
What are the key properties of (2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine?
(2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine has a molecular weight of 237.27 g/mol, XLogP of 1.98, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pyrido[3,2-d]pyrimidin-2-ylphenyl)hydrazine is sourced from PubChem (CID 67040292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).