C8H15N3 — CID 67040574
6-methyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine (PubChem CID 67040574) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 6-methyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine.
| Compound Name | 6-methyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 67040574 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 6-methyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine |
| SMILES | CC1CCNC2=NCCCN21 |
| InChI | InChI=1S/C8H15N3/c1-7-3-5-10-8-9-4-2-6-11(7)8/h7H,2-6H2,1H3,(H,9,10) |
| InChIKey | XUBFPWUIJGCVNV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |