About 2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine
2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine (PubChem CID 67041109) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine.
Molecular Properties
| Compound Name | 2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine |
| PubChem CID | 67041109 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine |
| SMILES | C1=CN(c2ccc[nH]2)NCC1 |
| InChI | InChI=1S/C8H11N3/c1-2-7-11(10-6-1)8-4-3-5-9-8/h2-5,7,9-10H,1,6H2 |
| InChIKey | FLNWYZVXENICKJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine?
The IUPAC name of 2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine (CID 67041109) is 2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine.
What is the SMILES notation for 2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine?
The canonical SMILES for 2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine is C1=CN(c2ccc[nH]2)NCC1.
What is the InChIKey of 2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine?
The InChIKey is FLNWYZVXENICKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-2-7-11(10-6-1)8-4-3-5-9-8/h2-5,7,9-10H,1,6H2.
What are the key properties of 2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine?
2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine has a molecular weight of 149.20 g/mol, XLogP of 1.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrrol-2-yl)-5,6-dihydro-1H-pyridazine is sourced from PubChem (CID 67041109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).