About 5-(tert-Butyl-diphenyl-silanyloxymethyl)-2H-pyrazole-3-carboxylic acid ethyl ester
5-(tert-Butyl-diphenyl-silanyloxymethyl)-2H-pyrazole-3-carboxylic acid ethyl ester (PubChem CID 67041269) has the molecular formula C23H26N2O3Si
and a molecular weight of 406.56 g/mol.
Molecular Properties
| Compound Name | 5-(tert-Butyl-diphenyl-silanyloxymethyl)-2H-pyrazole-3-carboxylic acid ethyl ester |
| PubChem CID | 67041269 |
| Molecular Formula | C23H26N2O3Si |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1cc(C(O[Si]C(C)(C)C)(c2ccccc2)c2ccccc2)[nH]n1 |
| InChI | InChI=1S/C23H26N2O3Si/c1-5-27-21(26)19-16-20(25-24-19)23(28-29-22(2,3)4,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16H,5H2,1-4H3,(H,24,25) |
| InChIKey | HUBMAKHSGQHRTO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-(tert-Butyl-diphenyl-silanyloxymethyl)-2H-pyrazole-3-carboxylic acid ethyl ester with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(tert-Butyl-diphenyl-silanyloxymethyl)-2H-pyrazole-3-carboxylic acid ethyl ester?
The IUPAC name of 5-(tert-Butyl-diphenyl-silanyloxymethyl)-2H-pyrazole-3-carboxylic acid ethyl ester (CID 67041269) is not available.
What is the SMILES notation for 5-(tert-Butyl-diphenyl-silanyloxymethyl)-2H-pyrazole-3-carboxylic acid ethyl ester?
The canonical SMILES for 5-(tert-Butyl-diphenyl-silanyloxymethyl)-2H-pyrazole-3-carboxylic acid ethyl ester is CCOC(=O)c1cc(C(O[Si]C(C)(C)C)(c2ccccc2)c2ccccc2)[nH]n1.
What is the InChIKey of 5-(tert-Butyl-diphenyl-silanyloxymethyl)-2H-pyrazole-3-carboxylic acid ethyl ester?
The InChIKey is HUBMAKHSGQHRTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O3Si/c1-5-27-21(26)19-16-20(25-24-19)23(28-29-22(2,3)4,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16H,5H2,1-4H3,(H,24,25).
What are the key properties of 5-(tert-Butyl-diphenyl-silanyloxymethyl)-2H-pyrazole-3-carboxylic acid ethyl ester?
5-(tert-Butyl-diphenyl-silanyloxymethyl)-2H-pyrazole-3-carboxylic acid ethyl ester has a molecular weight of 406.56 g/mol, XLogP of 4.73, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(tert-Butyl-diphenyl-silanyloxymethyl)-2H-pyrazole-3-carboxylic acid ethyl ester is sourced from PubChem (CID 67041269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).