C17H20N4O — CID 67041405
2-[(5-butyl-1,2-oxazol-3-yl)methyl]quinoline-3,4-diamine (PubChem CID 67041405) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[(5-butyl-1,2-oxazol-3-yl)methyl]quinoline-3,4-diamine.
| Compound Name | 2-[(5-butyl-1,2-oxazol-3-yl)methyl]quinoline-3,4-diamine |
|---|---|
| PubChem CID | 67041405 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-[(5-butyl-1,2-oxazol-3-yl)methyl]quinoline-3,4-diamine |
| SMILES | CCCCc1cc(Cc2nc3ccccc3c(N)c2N)no1 |
| InChI | InChI=1S/C17H20N4O/c1-2-3-6-12-9-11(21-22-12)10-15-17(19)16(18)13-7-4-5-8-14(13)20-15/h4-5,7-9H,2-3,6,10,19H2,1H3,(H2,18,20) |
| InChIKey | BPRTWJIUOBIJKS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |