About 1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate
1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate (PubChem CID 67041483) has the molecular formula C15H18ClN3O3
and a molecular weight of 323.78 g/mol. Its IUPAC name is 1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate.
Molecular Properties
| Compound Name | 1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate |
| PubChem CID | 67041483 |
| Molecular Formula | C15H18ClN3O3 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate |
| SMILES | O=C(NCc1ccc(Cl)cc1)OC1=NOC2(CCNCC2)C1 |
| InChI | InChI=1S/C15H18ClN3O3/c16-12-3-1-11(2-4-12)10-18-14(20)21-13-9-15(22-19-13)5-7-17-8-6-15/h1-4,17H,5-10H2,(H,18,20) |
| InChIKey | AQWQCTYVMVVSON-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate?
The IUPAC name of 1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate (CID 67041483) is 1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate.
What is the SMILES notation for 1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate?
The canonical SMILES for 1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate is O=C(NCc1ccc(Cl)cc1)OC1=NOC2(CCNCC2)C1.
What is the InChIKey of 1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate?
The InChIKey is AQWQCTYVMVVSON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3O3/c16-12-3-1-11(2-4-12)10-18-14(20)21-13-9-15(22-19-13)5-7-17-8-6-15/h1-4,17H,5-10H2,(H,18,20).
What are the key properties of 1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate?
1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate has a molecular weight of 323.78 g/mol, XLogP of 2.42, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl N-[(4-chlorophenyl)methyl]carbamate is sourced from PubChem (CID 67041483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).